cas: 2096332-16-8 — see every product listed under this CAS number, including other names
1-(2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-N,N-dimethylmethanamine hydrochloride 97% (CAS 2096332-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A760910-100mg |
| cas | 2096332-16-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A760910 |
1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride (CAS 2096332-16-8) is a chemical compound with the molecular formula C15H24BClFNO2 and a molecular weight of 315.6 g/mol. IUPAC name: 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride. InChIKey: MRPMMYAKEVQQJD-UHFFFAOYSA-N.
| Molecular formula | C15H24BClFNO2 |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride |
| InChIKey | MRPMMYAKEVQQJD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CN(C)C)F.Cl |
Computed by PubChem (NCBI)