cas: 1308380-33-7 — see every product listed under this CAS number, including other names
1-(2-Fluoro-6-(trifluoromethyl)benzyl)-6-methyl-5-(piperazin-1-yl)pyrimidine-2,4(1H,3H)-dione, 95%, 95% (CAS 1308380-33-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11A1WK-100mg |
| cas | 1308380-33-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2128.40 Pln | |
| Chemat | 250mg | 3506.00 Pln | |
| Chemat | 1g | 6952.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-piperazin-1-ylpyrimidine-2,4-dione (CAS 1308380-33-7) is a chemical compound with the molecular formula C17H18F4N4O2 and a molecular weight of 386.34 g/mol. IUPAC name: 1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-piperazin-1-ylpyrimidine-2,4-dione. InChIKey: JJGIZYSWXILRNG-UHFFFAOYSA-N.
| Molecular formula | C17H18F4N4O2 |
|---|---|
| Molecular weight | 386.34 g/mol |
| IUPAC name | 1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-5-piperazin-1-ylpyrimidine-2,4-dione |
| InChIKey | JJGIZYSWXILRNG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=O)N1CC2=C(C=CC=C2F)C(F)(F)F)N3CCNCC3 |
Computed by PubChem (NCBI)