cas: 106795-66-8 — see every product listed under this CAS number, including other names
1-(2-Fluorophenyl)cyclohexanecarboxylic acid, 95% (CAS 106795-66-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A138702-100mg |
| cas | 106795-66-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 122.08 Pln | |
| AmBeed | 250mg | 193.69 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-fluorophenyl)cyclohexane-1-carboxylic acid (CAS 106795-66-8) is a chemical compound with the molecular formula C13H15FO2 and a molecular weight of 222.25 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclohexane-1-carboxylic acid. InChIKey: ODLLDVJLQPBPPC-UHFFFAOYSA-N.
| Molecular formula | C13H15FO2 |
|---|---|
| Molecular weight | 222.25 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | ODLLDVJLQPBPPC-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)