cas: 2304635-54-7 — see every product listed under this CAS number, including other names
1-(2-METHOXY-1,1-DIMETHYL-ETHYL)PYRAZOLE-4-BORONIC ACID PINACOL ESTER, 97% (CAS 2304635-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F503783-100MG |
| cas | 2304635-54-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2018.06 Pln | |
| Fluorochem | 250mg | 3189.52 Pln | |
| Fluorochem | 500mg | 5261.71 Pln | |
| Fluorochem | 1g | 7849.34 Pln | |
| Fluorochem | 5g | 23401.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(1-methoxy-2-methylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2304635-54-7) is a chemical compound with the molecular formula C14H25BN2O3 and a molecular weight of 280.17 g/mol. IUPAC name: 1-(1-methoxy-2-methylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: KFQLIKUNPJXHSZ-UHFFFAOYSA-N.
| Molecular formula | C14H25BN2O3 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | 1-(1-methoxy-2-methylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | KFQLIKUNPJXHSZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)(C)COC |
Computed by PubChem (NCBI)