cas: 2096996-78-8 — see every product listed under this CAS number, including other names
1-(2-Methoxy-5-methylphenyl)-3-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 98% (CAS 2096996-78-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A640936-250mg |
| cas | 2096996-78-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1049.00 Pln | |
| Ambeed | 5g | 3719.00 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 1125.18 Pln | |
| BLDpharm | 5g | 4007.50 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 837.20 Pln | |
| Chemat | 5g | 2853.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(2-methoxy-5-methylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 2096996-78-8) is a chemical compound with the molecular formula C21H27BN2O4 and a molecular weight of 382.3 g/mol. IUPAC name: 1-(2-methoxy-5-methylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: FOQMPHUMVGMHPN-UHFFFAOYSA-N.
| Molecular formula | C21H27BN2O4 |
|---|---|
| Molecular weight | 382.3 g/mol |
| IUPAC name | 1-(2-methoxy-5-methylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | FOQMPHUMVGMHPN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)NC3=C(C=CC(=C3)C)OC |
Computed by PubChem (NCBI)