cas: 1200537-40-1 — see every product listed under this CAS number, including other names
1-(2-Methoxyethyl)-3,5-dimethyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%, 97% (CAS 1200537-40-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BJ2T-250mg |
| cas | 1200537-40-1 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1566.80 Pln | |
| Chemat | 10g | 3069.20 Pln | |
| Chemat | 100mg | 198.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2-methoxyethyl)-3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1200537-40-1) is a chemical compound with the molecular formula C14H25BN2O3 and a molecular weight of 280.17 g/mol. IUPAC name: 1-(2-methoxyethyl)-3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: LTQJJMKARMAXCA-UHFFFAOYSA-N.
| Molecular formula | C14H25BN2O3 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | 1-(2-methoxyethyl)-3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | LTQJJMKARMAXCA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2C)CCOC)C |
Computed by PubChem (NCBI)