cas: 327069-81-8 — see every product listed under this CAS number, including other names
1-(2-Nitrophenylsulfonyl)pyrrolidine (CAS 327069-81-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118IYP-1g |
| cas | 327069-81-8 |
| size | 1g |
| availability | 85.41g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 822.80 Pln |
| delivery time | 3 weeks |
|---|
1-(2-nitrophenyl)sulfonylpyrrolidine (CAS 327069-81-8) is a chemical compound with the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. IUPAC name: 1-(2-nitrophenyl)sulfonylpyrrolidine. InChIKey: TVCJPXJRFSPNIZ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 1-(2-nitrophenyl)sulfonylpyrrolidine |
| InChIKey | TVCJPXJRFSPNIZ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)