1-(2-Phenylpropan-2-yl)thiourea, 97%
cas: 1866229-17-5 — see every product listed under this CAS number, including other names
1-(2-Phenylpropan-2-yl)thiourea, 97% (CAS 1866229-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1282554-100mg |
| cas | 1866229-17-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 948.88 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 275.48 Pln | |
| BLDpharm | 5g | 1019.67 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 760.40 Pln | |
| Fluorochem | 5g | 1414.10 Pln | |
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 461.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-phenylpropan-2-ylthiourea (CAS 1866229-17-5) is a chemical compound with the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. IUPAC name: 2-phenylpropan-2-ylthiourea. InChIKey: IWDZEAMBALEICF-UHFFFAOYSA-N.
| Molecular formula | C10H14N2S |
|---|---|
| Molecular weight | 194.30 g/mol |
| IUPAC name | 2-phenylpropan-2-ylthiourea |
| InChIKey | IWDZEAMBALEICF-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)NC(=S)N |
Computed by PubChem (NCBI)