cas: 1400225-39-9 — see every product listed under this CAS number, including other names
1-(2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-3-(p-tolyl)urea, 95%, 95% (CAS 1400225-39-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTM9-250mg |
| cas | 1400225-39-9 |
| size | 250mg |
| availability | 7.95g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1302.80 Pln | |
| Chemat | 5g | 3784.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(4-methylphenyl)urea (CAS 1400225-39-9) is a chemical compound with the molecular formula C20H24BClN2O3 and a molecular weight of 386.7 g/mol. IUPAC name: 1-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(4-methylphenyl)urea. InChIKey: UGNFQZGKQHTQAX-UHFFFAOYSA-N.
| Molecular formula | C20H24BClN2O3 |
|---|---|
| Molecular weight | 386.7 g/mol |
| IUPAC name | 1-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(4-methylphenyl)urea |
| InChIKey | UGNFQZGKQHTQAX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)NC(=O)NC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)