cas: 1289387-38-7 — see every product listed under this CAS number, including other names
1-(2-fluorobenzyl)azetidine-3-carboxylic acid, 95%, 95% (CAS 1289387-38-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YMJ-100mg |
| cas | 1289387-38-7 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 966.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(2-fluorophenyl)methyl]azetidine-3-carboxylic acid (CAS 1289387-38-7) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]azetidine-3-carboxylic acid. InChIKey: JTTUTTJHLWTABB-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 1-[(2-fluorophenyl)methyl]azetidine-3-carboxylic acid |
| InChIKey | JTTUTTJHLWTABB-UHFFFAOYSA-N |
| SMILES | C1C(CN1CC2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)