cas: 874299-26-0 — see every product listed under this CAS number, including other names
1-(2-methoxyethyl)-3-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 95%, 95% (CAS 874299-26-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEL1-250mg |
| cas | 874299-26-0 |
| size | 250mg |
| availability | 5.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 1994.00 Pln | |
| Chemat | 5g | 5920.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2-methoxyethyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874299-26-0) is a chemical compound with the molecular formula C16H25BN2O4 and a molecular weight of 320.2 g/mol. IUPAC name: 1-(2-methoxyethyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: HJCRQUOXLLSLOC-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O4 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | 1-(2-methoxyethyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | HJCRQUOXLLSLOC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)NCCOC |
Computed by PubChem (NCBI)