cas: 2704188-30-5 — see every product listed under this CAS number, including other names
1-(3,3-Difluorocyclobutyl)piperazine dihydrochloride, 97% (CAS 2704188-30-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1639222-10g |
| cas | 2704188-30-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 23675.26 Pln | |
| AmBeed | 5g | 15583.33 Pln | |
| Fluorochem | 100mg | 1606.74 Pln | |
| Fluorochem | 250mg | 2085.74 Pln | |
| Fluorochem | 500mg | 3397.78 Pln | |
| Fluorochem | 1g | 5058.65 Pln | |
| Fluorochem | 5g | 14732.33 Pln | |
| Fluorochem | 10g | 24504.93 Pln | |
| Chemat | 100mg | 957.20 Pln | |
| Chemat | 250mg | 1250.00 Pln | |
| Chemat | 500mg | 2042.00 Pln | |
| Chemat | 1g | 3035.60 Pln | |
| Chemat | 5g | 8978.00 Pln | |
| Chemat | 10g | 14920.40 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(3,3-difluorocyclobutyl)piperazine;dihydrochloride (CAS 2704188-30-5) is a chemical compound with the molecular formula C8H16Cl2F2N2 and a molecular weight of 249.13 g/mol. IUPAC name: 1-(3,3-difluorocyclobutyl)piperazine;dihydrochloride. InChIKey: ZGTYQXKBVYXOAY-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2F2N2 |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 1-(3,3-difluorocyclobutyl)piperazine;dihydrochloride |
| InChIKey | ZGTYQXKBVYXOAY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2CC(C2)(F)F.Cl.Cl |
Computed by PubChem (NCBI)