cas: 942609-64-5 — see every product listed under this CAS number, including other names
1-(3,4-Dimethylphenyl)-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 95%, 95% (CAS 942609-64-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNNP-250mg |
| cas | 942609-64-5 |
| size | 250mg |
| availability | 4.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1082.00 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3,4-dimethylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 942609-64-5) is a chemical compound with the molecular formula C21H27BN2O3 and a molecular weight of 366.3 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: IZOSKIUVSCKIPY-UHFFFAOYSA-N.
| Molecular formula | C21H27BN2O3 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | IZOSKIUVSCKIPY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)C)C |
Computed by PubChem (NCBI)