cas: 851477-20-8 — see every product listed under this CAS number, including other names
1-(3,5-Bis(trifluoromethyl)phenyl)-3-((1S,2S)-2-(dimethylamino)cyclohexyl)thiourea 98% (CAS 851477-20-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A751788-100mg |
| cas | 851477-20-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 876.56 Pln | |
| Ambeed | 25g | 2562.00 Pln | |
| Ambeed | 100g | 8052.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A751788 |
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]thiourea (CAS 851477-20-8) is a chemical compound with the molecular formula C17H21F6N3S and a molecular weight of 413.4 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]thiourea. InChIKey: NQRCAVZHOLYEBJ-KBPBESRZSA-N.
| Molecular formula | C17H21F6N3S |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]thiourea |
| InChIKey | NQRCAVZHOLYEBJ-KBPBESRZSA-N |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1NC(=S)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)