cas: 1261995-07-6 — see every product listed under this CAS number, including other names
1-(3,5-Dibromophenyl)piperidine, 97%, 97% (CAS 1261995-07-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111SBD-250mg |
| cas | 1261995-07-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 25g | 1888.40 Pln | |
| Chemat | 10g | 923.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3,5-dibromophenyl)piperidine (CAS 1261995-07-6) is a chemical compound with the molecular formula C11H13Br2N and a molecular weight of 319.04 g/mol. IUPAC name: 1-(3,5-dibromophenyl)piperidine. InChIKey: XJRXMTGCKLGGJU-UHFFFAOYSA-N.
| Molecular formula | C11H13Br2N |
|---|---|
| Molecular weight | 319.04 g/mol |
| IUPAC name | 1-(3,5-dibromophenyl)piperidine |
| InChIKey | XJRXMTGCKLGGJU-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)