cas: 884507-45-3 — see every product listed under this CAS number, including other names
1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)pyrrolidine 95% (CAS 884507-45-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352526-250mg |
| cas | 884507-45-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 10g | 1093.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A352526 |
1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (CAS 884507-45-3) is a chemical compound with the molecular formula C17H26BNO2 and a molecular weight of 287.2 g/mol. IUPAC name: 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine. InChIKey: AKQLICZDOCQKRA-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO2 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| InChIKey | AKQLICZDOCQKRA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CN3CCCC3 |
Computed by PubChem (NCBI)