cas: 819056-45-6 — see every product listed under this CAS number, including other names
1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-3-(m-tolyl)urea, 95-<97% (CAS 819056-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1037-95-97-1g |
| cas | 819056-45-6 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 3765.96 Pln | |
| Hoffman Fine Chemicals | 2,5g | 6362.62 Pln | |
| Hoffman Fine Chemicals | 5g | 9992.84 Pln | |
| Hoffman Fine Chemicals | 10g | 15798.64 Pln | |
| Hoffman Fine Chemicals | 25g | 31289.28 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-(3-methylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 819056-45-6) is a chemical compound with the molecular formula C20H25BN2O3 and a molecular weight of 352.2 g/mol. IUPAC name: 1-(3-methylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: GBWHYXZCAAQLDK-UHFFFAOYSA-N.
| Molecular formula | C20H25BN2O3 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | 1-(3-methylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | GBWHYXZCAAQLDK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)NC3=CC=CC(=C3)C |
Computed by PubChem (NCBI)