cas: 852227-97-5 — see every product listed under this CAS number, including other names
1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidine 97% (CAS 852227-97-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A738778-250mg |
| cas | 852227-97-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 392.62 Pln | |
| Ambeed | 5g | 882.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A738778 |
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine (CAS 852227-97-5) is a chemical compound with the molecular formula C17H26BNO2 and a molecular weight of 287.2 g/mol. IUPAC name: 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine. InChIKey: IIUXWPXCCXVCPD-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO2 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
| InChIKey | IIUXWPXCCXVCPD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N3CCCCC3 |
Computed by PubChem (NCBI)