cas: 320727-36-4 — see every product listed under this CAS number, including other names
1-(3-(Benzyloxy)phenyl)ethanol 97% (CAS 320727-36-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A264762-250mg |
| cas | 320727-36-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1694.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A264762 |
1-(3-phenylmethoxyphenyl)ethanol (CAS 320727-36-4) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: 1-(3-phenylmethoxyphenyl)ethanol. InChIKey: TZTSJUPGQORXJB-UHFFFAOYSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 1-(3-phenylmethoxyphenyl)ethanol |
| InChIKey | TZTSJUPGQORXJB-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)