cas: 823809-16-1 — see every product listed under this CAS number, including other names
1-(3-Aminopropyl)-2-(ethoxymethyl)-1H-imidazo[4,5-c]quinolin-4-amine 97% (CAS 823809-16-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1151726-25mg |
| cas | 823809-16-1 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 1432.81 Pln | |
| Ambeed | 50mg | 2178.19 Pln | |
| Ambeed | 100mg | 3657.81 Pln | |
| Ambeed | 250mg | 6561.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1151726 |
1-(3-aminopropyl)-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine (CAS 823809-16-1) is a chemical compound with the molecular formula C16H21N5O and a molecular weight of 299.37 g/mol. IUPAC name: 1-(3-aminopropyl)-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine. InChIKey: HVJUMTMMTHTXOF-UHFFFAOYSA-N.
| Molecular formula | C16H21N5O |
|---|---|
| Molecular weight | 299.37 g/mol |
| IUPAC name | 1-(3-aminopropyl)-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine |
| InChIKey | HVJUMTMMTHTXOF-UHFFFAOYSA-N |
| SMILES | CCOCC1=NC2=C(N1CCCN)C3=CC=CC=C3N=C2N |
Computed by PubChem (NCBI)