cas: 1636130-32-9 — see every product listed under this CAS number, including other names
1-(3-Bromo-5-(tert-butyl)phenyl)-1H-imidazole, 95%, 95% (CAS 1636130-32-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XCZ4-100mg |
| cas | 1636130-32-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 947.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromo-5-tert-butylphenyl)imidazole (CAS 1636130-32-9) is a chemical compound with the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. IUPAC name: 1-(3-bromo-5-tert-butylphenyl)imidazole. InChIKey: OYKQNEPSFWEICJ-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2 |
|---|---|
| Molecular weight | 279.18 g/mol |
| IUPAC name | 1-(3-bromo-5-tert-butylphenyl)imidazole |
| InChIKey | OYKQNEPSFWEICJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)Br)N2C=CN=C2 |
Computed by PubChem (NCBI)