cas: 1261895-87-7 — see every product listed under this CAS number, including other names
1-(3-Bromo-5-chlorophenyl)pyrrolidine, 97%, 97% (CAS 1261895-87-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111S4T-250mg |
| cas | 1261895-87-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1994.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromo-5-chlorophenyl)pyrrolidine (CAS 1261895-87-7) is a chemical compound with the molecular formula C10H11BrClN and a molecular weight of 260.56 g/mol. IUPAC name: 1-(3-bromo-5-chlorophenyl)pyrrolidine. InChIKey: ZUVZTBKZTVMAIC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClN |
|---|---|
| Molecular weight | 260.56 g/mol |
| IUPAC name | 1-(3-bromo-5-chlorophenyl)pyrrolidine |
| InChIKey | ZUVZTBKZTVMAIC-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)