cas: 31197-30-5 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)piperazine, 97%, 97% (CAS 31197-30-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BD8L-250mg |
| cas | 31197-30-5 |
| size | 250mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 100mg | 170.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromophenyl)piperazine (CAS 31197-30-5) is a chemical compound with the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. IUPAC name: 1-(3-bromophenyl)piperazine. InChIKey: DOYNABJKDZARLF-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2 |
|---|---|
| Molecular weight | 241.13 g/mol |
| IUPAC name | 1-(3-bromophenyl)piperazine |
| InChIKey | DOYNABJKDZARLF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)