1-(3-Bromophenyl)piperidin-4-amine, 95%
cas: 1179833-02-3 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)piperidin-4-amine, 95% (CAS 1179833-02-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A393899-100mg |
| cas | 1179833-02-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 548.38 Pln | |
| Ambeed | 250mg | 876.56 Pln | |
| Ambeed | 1g | 2233.81 Pln | |
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 923.60 Pln | |
| Chemat | 1g | 2378.00 Pln | |
| BLDpharm | 100mg | 580.93 Pln | |
| BLDpharm | 250mg | 936.36 Pln | |
| BLDpharm | 1g | 2402.51 Pln | |
| Fluorochem | 100mg | 1044.44 Pln | |
| Fluorochem | 250mg | 1700.46 Pln | |
| Fluorochem | 1g | 4397.43 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(3-bromophenyl)piperidin-4-amine (CAS 1179833-02-3) is a chemical compound with the molecular formula C11H15BrN2 and a molecular weight of 255.15 g/mol. IUPAC name: 1-(3-bromophenyl)piperidin-4-amine. InChIKey: OKHLYQNSSYEMLG-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2 |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 1-(3-bromophenyl)piperidin-4-amine |
| InChIKey | OKHLYQNSSYEMLG-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)