cas: 2377033-82-2 — see every product listed under this CAS number, including other names
1-(3-Bromopyridin-2-yl)ethan-1-amine dihydrochloride, 95%, 95% (CAS 2377033-82-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUQ4-100mg |
| cas | 2377033-82-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 1g | 1710.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromo-2-pyridinyl)ethanamine;dihydrochloride (CAS 2377033-82-2) is a chemical compound with the molecular formula C7H11BrCl2N2 and a molecular weight of 273.98 g/mol. IUPAC name: 1-(3-bromo-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: RJXDYWIOKKTXDP-UHFFFAOYSA-N.
| Molecular formula | C7H11BrCl2N2 |
|---|---|
| Molecular weight | 273.98 g/mol |
| IUPAC name | 1-(3-bromo-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | RJXDYWIOKKTXDP-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC=N1)Br)N.Cl.Cl |
Computed by PubChem (NCBI)