cas: 1256360-54-9 — see every product listed under this CAS number, including other names
1-(3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)pyrrolidine 95% (CAS 1256360-54-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A305501-100mg |
| cas | 1256360-54-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 281.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A305501 |
1-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (CAS 1256360-54-9) is a chemical compound with the molecular formula C17H25BClNO2 and a molecular weight of 321.7 g/mol. IUPAC name: 1-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine. InChIKey: RENGUKGWLBTWKR-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO2 |
|---|---|
| Molecular weight | 321.7 g/mol |
| IUPAC name | 1-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| InChIKey | RENGUKGWLBTWKR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CN3CCCC3)Cl |
Computed by PubChem (NCBI)