cas: 1072945-88-0 — see every product listed under this CAS number, including other names
1-(3-Chlorophenyl)pyrazole-4-boronic acid 98% (CAS 1072945-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A290989-100mg |
| cas | 1072945-88-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 531.69 Pln | |
| Ambeed | 5g | 1455.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A290989 |
[1-(3-chlorophenyl)pyrazol-4-yl]boronic acid (CAS 1072945-88-0) is a chemical compound with the molecular formula C9H8BClN2O2 and a molecular weight of 222.44 g/mol. IUPAC name: [1-(3-chlorophenyl)pyrazol-4-yl]boronic acid. InChIKey: QQIIJLJSZUIAKB-UHFFFAOYSA-N.
| Molecular formula | C9H8BClN2O2 |
|---|---|
| Molecular weight | 222.44 g/mol |
| IUPAC name | [1-(3-chlorophenyl)pyrazol-4-yl]boronic acid |
| InChIKey | QQIIJLJSZUIAKB-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC(=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)