cas: 2096998-21-7 — see every product listed under this CAS number, including other names
1-(3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropane-1-carboxylic acid, 97% (CAS 2096998-21-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694409-50MG |
| cas | 2096998-21-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 612.30 Pln | |
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 1185.02 Pln | |
| Fluorochem | 1g | 3382.16 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid (CAS 2096998-21-7) is a chemical compound with the molecular formula C16H20BFO4 and a molecular weight of 306.1 g/mol. IUPAC name: 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: LHIZEFZZPHIOAV-UHFFFAOYSA-N.
| Molecular formula | C16H20BFO4 |
|---|---|
| Molecular weight | 306.1 g/mol |
| IUPAC name | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | LHIZEFZZPHIOAV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C3(CC3)C(=O)O)F |
Computed by PubChem (NCBI)