cas: 855715-34-3 — see every product listed under this CAS number, including other names
1-(3-Methoxyphenyl)-N1,N1-dimethylethane-1,2-diamine, 98% (CAS 855715-34-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A390395-10g |
| cas | 855715-34-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10225.60 Pln | |
| AmBeed | 5g | 6801.34 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(3-methoxyphenyl)-N,N-dimethylethane-1,2-diamine (CAS 855715-34-3) is a chemical compound with the molecular formula C11H18N2O and a molecular weight of 194.27 g/mol. IUPAC name: 1-(3-methoxyphenyl)-N,N-dimethylethane-1,2-diamine. InChIKey: ZTMHUNSEVFJKER-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-N,N-dimethylethane-1,2-diamine |
| InChIKey | ZTMHUNSEVFJKER-UHFFFAOYSA-N |
| SMILES | CN(C)C(CN)C1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)