cas: 84162-82-3 — see every product listed under this CAS number, including other names
1-(4-(2,4-Difluorobenzoyl)piperidin-1-yl)ethanone, 97%, 97% (CAS 84162-82-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3X2-100mg |
| cas | 84162-82-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1346.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethanone (CAS 84162-82-3) is a chemical compound with the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. IUPAC name: 1-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethanone. InChIKey: UGPWQEIGJWVJDR-UHFFFAOYSA-N.
| Molecular formula | C14H15F2NO2 |
|---|---|
| Molecular weight | 267.27 g/mol |
| IUPAC name | 1-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethanone |
| InChIKey | UGPWQEIGJWVJDR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(CC1)C(=O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)