cas: 87549-35-7 — see every product listed under this CAS number, including other names
1-(4-(2-(Cyclopropylmethoxy)-1-hydroxyethyl)phenoxy)-3-(isopropylamino)propan-2-ol, 95%, 95% (CAS 87549-35-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DTK-100mg |
| cas | 87549-35-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 4888.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[4-[2-(cyclopropylmethoxy)-1-hydroxyethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol (CAS 87549-35-7) is a chemical compound with the molecular formula C18H29NO4 and a molecular weight of 323.4 g/mol. IUPAC name: 1-[4-[2-(cyclopropylmethoxy)-1-hydroxyethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol. InChIKey: NDOYCLDFWYZWIO-UHFFFAOYSA-N.
| Molecular formula | C18H29NO4 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 1-[4-[2-(cyclopropylmethoxy)-1-hydroxyethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| InChIKey | NDOYCLDFWYZWIO-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)C(COCC2CC2)O)O |
Computed by PubChem (NCBI)