cas: 1782228-76-5 — see every product listed under this CAS number, including other names
1-(4-(3-(Piperidin-1-yl)propoxy)benzyl)piperidine dihydrochloride, ≥99%(HPLC) (CAS 1782228-76-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12KX8R-5mg |
| cas | 1782228-76-5 |
| size | 5mg |
| availability | 0.7g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 693.20 Pln | |
| Chemat | 10mg | 1221.20 Pln | |
| Chemat | 25mg | 2382.80 Pln | |
| Chemat | 50mg | 4682.00 Pln | |
| Chemat | 100mg | 7365.20 Pln | |
| Fluorochem | 5mg | 1278.73 Pln | |
| Fluorochem | 10mg | 2267.97 Pln | |
| Fluorochem | 25mg | 4413.05 Pln | |
| Fluorochem | 50mg | 8526.18 Pln | |
| Fluorochem | 100mg | 13441.12 Pln |
| purity | ≥99%(HPLC) |
|---|---|
| delivery time | 3 weeks |
1-[3-[4-(piperidin-1-ylmethyl)phenoxy]propyl]piperidine;dihydrochloride (CAS 1782228-76-5) is a chemical compound with the molecular formula C20H34Cl2N2O and a molecular weight of 389.4 g/mol. IUPAC name: 1-[3-[4-(piperidin-1-ylmethyl)phenoxy]propyl]piperidine;dihydrochloride. InChIKey: RLLXSVVZCGBIJR-UHFFFAOYSA-N.
| Molecular formula | C20H34Cl2N2O |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 1-[3-[4-(piperidin-1-ylmethyl)phenoxy]propyl]piperidine;dihydrochloride |
| InChIKey | RLLXSVVZCGBIJR-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCCOC2=CC=C(C=C2)CN3CCCCC3.Cl.Cl |
Computed by PubChem (NCBI)