cas: 1116229-11-8 — see every product listed under this CAS number, including other names
1-(4-(3-Methoxy-4-nitrophenyl)piperazin-1-yl)ethanone, 98% (CAS 1116229-11-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A456432-25g |
| cas | 1116229-11-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 3539.83 Pln | |
| AmBeed | 10g | 1632.40 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 633.13 Pln | |
| Fluorochem | 10g | 1028.82 Pln | |
| Fluorochem | 25g | 2215.90 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[4-(3-methoxy-4-nitrophenyl)piperazin-1-yl]ethanone (CAS 1116229-11-8) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: 1-[4-(3-methoxy-4-nitrophenyl)piperazin-1-yl]ethanone. InChIKey: GUTDYFMBYFDQBU-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 1-[4-(3-methoxy-4-nitrophenyl)piperazin-1-yl]ethanone |
| InChIKey | GUTDYFMBYFDQBU-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)C2=CC(=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)