cas: 884507-39-5 — see every product listed under this CAS number, including other names
1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)pyrrolidine 97% (CAS 884507-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114930-1g |
| cas | 884507-39-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 10g | 698.56 Pln | |
| Ambeed | 25g | 1616.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A114930 |
1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (CAS 884507-39-5) is a chemical compound with the molecular formula C17H26BNO2 and a molecular weight of 287.2 g/mol. IUPAC name: 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine. InChIKey: AGSIDMRVRGPBIE-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO2 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| InChIKey | AGSIDMRVRGPBIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN3CCCC3 |
Computed by PubChem (NCBI)