1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanamine hydrochloride, 95%
cas: 2828438-22-6 — see every product listed under this CAS number, including other names
1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanamine hydrochloride, 95% (CAS 2828438-22-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1515866-250mg |
| cas | 2828438-22-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 993.38 Pln | |
| Ambeed | 5g | 3785.75 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 397.66 Pln | |
| BLDpharm | 1g | 975.24 Pln | |
| BLDpharm | 5g | 3707.61 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 1g | 1221.20 Pln | |
| Chemat | 5g | 4686.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropan-1-amine;hydrochloride (CAS 2828438-22-6) is a chemical compound with the molecular formula C15H23BClNO2 and a molecular weight of 295.6 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropan-1-amine;hydrochloride. InChIKey: HHTIIBHICWQHCY-UHFFFAOYSA-N.
| Molecular formula | C15H23BClNO2 |
|---|---|
| Molecular weight | 295.6 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropan-1-amine;hydrochloride |
| InChIKey | HHTIIBHICWQHCY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CC3)N.Cl |
Computed by PubChem (NCBI)