cas: 1802907-91-0 — see every product listed under this CAS number, including other names
1-(4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenoxy)-3,6,9,12-tetraoxapentadecan-15-oic acid, 98%, 98% (CAS 1802907-91-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I11Z-25mg |
| cas | 1802907-91-0 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 568.40 Pln | |
| Chemat | 50mg | 947.60 Pln | |
| Chemat | 100mg | 1341.20 Pln | |
| Chemat | 250mg | 2718.80 Pln | |
| Chemat | 1g | 6789.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1802907-91-0) is a chemical compound with the molecular formula C20H28N4O7 and a molecular weight of 436.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: LMFGOJBYDNENPR-UHFFFAOYSA-N.
| Molecular formula | C20H28N4O7 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | LMFGOJBYDNENPR-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)OCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)