cas: 1620278-72-9 — see every product listed under this CAS number, including other names
1-(4-(Aminomethyl)benzyl)-2-butyl-1H-imidazo[4,5-c]quinolin-4-amine dihydrochloride, 95%, 95% (CAS 1620278-72-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ANY-10mg |
| cas | 1620278-72-9 |
| size | 10mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 338.00 Pln | |
| Chemat | 25mg | 611.60 Pln | |
| Chemat | 50mg | 1053.20 Pln | |
| Chemat | 100mg | 1163.60 Pln | |
| Chemat | 250mg | 1994.00 Pln | |
| Chemat | 1g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[[4-(aminomethyl)phenyl]methyl]-2-butylimidazo[4,5-c]quinolin-4-amine;dihydrochloride (CAS 1620278-72-9) is a chemical compound with the molecular formula C22H27Cl2N5 and a molecular weight of 432.4 g/mol. IUPAC name: 1-[[4-(aminomethyl)phenyl]methyl]-2-butylimidazo[4,5-c]quinolin-4-amine;dihydrochloride. InChIKey: YKZCFKIAMHQQAW-UHFFFAOYSA-N.
| Molecular formula | C22H27Cl2N5 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | 1-[[4-(aminomethyl)phenyl]methyl]-2-butylimidazo[4,5-c]quinolin-4-amine;dihydrochloride |
| InChIKey | YKZCFKIAMHQQAW-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(N1CC3=CC=C(C=C3)CN)C4=CC=CC=C4N=C2N.Cl.Cl |
Computed by PubChem (NCBI)