CAS 889675-05-2 appears in our catalog under these names: 1–(4–(Benzyloxy)–1–(phenylsulfonyl)–1H–indol–2–yl)ethanone, 1-(4-(Benzyloxy)-1-(phenylsulfonyl)-1H-indol-2-yl)ethanone, 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 1g.
1-[1-(benzenesulfonyl)-4-phenylmethoxyindol-2-yl]ethanone (CAS 889675-05-2) is a chemical compound with the molecular formula C23H19NO4S and a molecular weight of 405.5 g/mol. IUPAC name: 1-[1-(benzenesulfonyl)-4-phenylmethoxyindol-2-yl]ethanone. InChIKey: DYXUXCLRQONFQD-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4S |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | 1-[1-(benzenesulfonyl)-4-phenylmethoxyindol-2-yl]ethanone |
| InChIKey | DYXUXCLRQONFQD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(N1S(=O)(=O)C3=CC=CC=C3)C=CC=C2OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)