cas: 794554-83-9 — see every product listed under this CAS number, including other names
1-(4-[(Diethylamino)sulfonyl]phenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%, 95% (CAS 794554-83-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G4WJ-100mg |
| cas | 794554-83-9 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 966.80 Pln | |
| Chemat | 250mg | 1350.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 794554-83-9) is a chemical compound with the molecular formula C15H20N2O5S and a molecular weight of 340.4 g/mol. IUPAC name: 1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: XNCZUJCDBHKBLN-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O5S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | XNCZUJCDBHKBLN-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)N2CC(CC2=O)C(=O)O |
Computed by PubChem (NCBI)