cas: 1192944-73-2 — see every product listed under this CAS number, including other names
1-(4-{3-[(4-Fluorobenzyl)oxy]-5-(3-fluorophenyl)-1H-1,2,4-triazol-1-yl}phenyl)-3-(3-methoxyphenyl)urea, 95%, 95% (CAS 1192944-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IIZ-100mg |
| cas | 1192944-73-2 |
| size | 100mg |
| availability | 1.28g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[4-[5-(3-fluorophenyl)-3-[(4-fluorophenyl)methoxy]-1,2,4-triazol-1-yl]phenyl]-3-(3-methoxyphenyl)urea (CAS 1192944-73-2) is a chemical compound with the molecular formula C29H23F2N5O3 and a molecular weight of 527.5 g/mol. IUPAC name: 1-[4-[5-(3-fluorophenyl)-3-[(4-fluorophenyl)methoxy]-1,2,4-triazol-1-yl]phenyl]-3-(3-methoxyphenyl)urea. InChIKey: ZIRIGRBVGZQBSS-UHFFFAOYSA-N.
| Molecular formula | C29H23F2N5O3 |
|---|---|
| Molecular weight | 527.5 g/mol |
| IUPAC name | 1-[4-[5-(3-fluorophenyl)-3-[(4-fluorophenyl)methoxy]-1,2,4-triazol-1-yl]phenyl]-3-(3-methoxyphenyl)urea |
| InChIKey | ZIRIGRBVGZQBSS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC(=O)NC2=CC=C(C=C2)N3C(=NC(=N3)OCC4=CC=C(C=C4)F)C5=CC(=CC=C5)F |
Computed by PubChem (NCBI)