cas: 211247-62-0 — see every product listed under this CAS number, including other names
1-(4-Aminophenyl)-N,N-dimethylpiperidin-4-amine, 98%, 98% (CAS 211247-62-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113L9V-100mg |
| cas | 211247-62-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 755.60 Pln | |
| Chemat | 1g | 1451.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-aminophenyl)-N,N-dimethylpiperidin-4-amine (CAS 211247-62-0) is a chemical compound with the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. IUPAC name: 1-(4-aminophenyl)-N,N-dimethylpiperidin-4-amine. InChIKey: PFDUBQQHEHJNQX-UHFFFAOYSA-N.
| Molecular formula | C13H21N3 |
|---|---|
| Molecular weight | 219.33 g/mol |
| IUPAC name | 1-(4-aminophenyl)-N,N-dimethylpiperidin-4-amine |
| InChIKey | PFDUBQQHEHJNQX-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCN(CC1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)