cas: 1286264-64-9 — see every product listed under this CAS number, including other names
1-(4-Aminopiperidin-1-yl)-2,2-dimethylpropan-1-one hydrochloride, 97%, 97% (CAS 1286264-64-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12B33M-100mg |
| cas | 1286264-64-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 3381.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-aminopiperidin-1-yl)-2,2-dimethylpropan-1-one;hydrochloride (CAS 1286264-64-9) is a chemical compound with the molecular formula C10H21ClN2O and a molecular weight of 220.74 g/mol. IUPAC name: 1-(4-aminopiperidin-1-yl)-2,2-dimethylpropan-1-one;hydrochloride. InChIKey: HFVRCQFTPHQEQX-UHFFFAOYSA-N.
| Molecular formula | C10H21ClN2O |
|---|---|
| Molecular weight | 220.74 g/mol |
| IUPAC name | 1-(4-aminopiperidin-1-yl)-2,2-dimethylpropan-1-one;hydrochloride |
| InChIKey | HFVRCQFTPHQEQX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1CCC(CC1)N.Cl |
Computed by PubChem (NCBI)