cas: 65069-53-6 — see every product listed under this CAS number, including other names
1-(4-Benzyloxyphenyl)-2-thiourea (CAS 65069-53-6) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 250mg, 500mg, 1g, 2.5g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | QCA06953-2,5g |
| cas | 65069-53-6 |
| size | 2,5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 2,5g | price on request | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 500mg | 487.35 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 2.5g | 2002.44 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
(4-phenylmethoxyphenyl)thiourea (CAS 65069-53-6) is a chemical compound with the molecular formula C14H14N2OS and a molecular weight of 258.34 g/mol. IUPAC name: (4-phenylmethoxyphenyl)thiourea. InChIKey: TVUKNBBQSFMNAL-UHFFFAOYSA-N.
| Molecular formula | C14H14N2OS |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | (4-phenylmethoxyphenyl)thiourea |
| InChIKey | TVUKNBBQSFMNAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)NC(=S)N |
Computed by PubChem (NCBI)