cas: 501903-60-2 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-methylphenyl)piperazine, >97%, >97% (CAS 501903-60-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CY8-100mg |
| cas | 501903-60-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 5g | 2464.40 Pln | |
| Chemat | 10g | 4418.00 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-2-methylphenyl)piperazine (CAS 501903-60-2) is a chemical compound with the molecular formula C11H15BrN2 and a molecular weight of 255.15 g/mol. IUPAC name: 1-(4-bromo-2-methylphenyl)piperazine. InChIKey: QHGLIYDUBUVNLV-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2 |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 1-(4-bromo-2-methylphenyl)piperazine |
| InChIKey | QHGLIYDUBUVNLV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)N2CCNCC2 |
Computed by PubChem (NCBI)