cas: 178162-69-1 — see every product listed under this CAS number, including other names
1-(4-Bromobenzyl)piperidine 97% (CAS 178162-69-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A778070-1g |
| cas | 178162-69-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 25g | 3107.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A778070 |
1-[(4-bromophenyl)methyl]piperidine (CAS 178162-69-1) is a chemical compound with the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. IUPAC name: 1-[(4-bromophenyl)methyl]piperidine. InChIKey: ILQFFXGIIWWTNH-UHFFFAOYSA-N.
| Molecular formula | C12H16BrN |
|---|---|
| Molecular weight | 254.17 g/mol |
| IUPAC name | 1-[(4-bromophenyl)methyl]piperidine |
| InChIKey | ILQFFXGIIWWTNH-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)