CAS 39229-12-4 appears in our catalog under these names: 1–(4–bromophenyl)–2–phenylethane–1,2–dione, 1-(4-Bromophenyl)-2-phenylethane-1,2-dione, 98%, 1-(4-Bromophenyl)-2-phenylethane-1,2-dione, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
1-(4-bromophenyl)-2-phenylethane-1,2-dione (CAS 39229-12-4) is a chemical compound with the molecular formula C14H9BrO2 and a molecular weight of 289.12 g/mol. IUPAC name: 1-(4-bromophenyl)-2-phenylethane-1,2-dione. InChIKey: REKFALFAMJBFCR-UHFFFAOYSA-N.
| Molecular formula | C14H9BrO2 |
|---|---|
| Molecular weight | 289.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-phenylethane-1,2-dione |
| InChIKey | REKFALFAMJBFCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)