cas: 66698-28-0 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)piperazine, 98%, 98% (CAS 66698-28-0) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CYM-50g |
| cas | 66698-28-0 |
| size | 50g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 496.40 Pln | |
| Chemat | 250g | 1979.60 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 918.80 Pln | |
| Chemat | 500g | 3513.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)piperazine (CAS 66698-28-0) is a chemical compound with the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. IUPAC name: 1-(4-bromophenyl)piperazine. InChIKey: PJHPFAFEJNBIDC-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2 |
|---|---|
| Molecular weight | 241.13 g/mol |
| IUPAC name | 1-(4-bromophenyl)piperazine |
| InChIKey | PJHPFAFEJNBIDC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)