cas: 314744-43-9 — see every product listed under this CAS number, including other names
1-(4-Chloro-benzenesulfonyl)-piperidine-4-carboxylic acid, 95% (CAS 314744-43-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027851-1G |
| cas | 314744-43-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1684.84 Pln | |
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 247.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylic acid (CAS 314744-43-9) is a chemical compound with the molecular formula C12H14ClNO4S and a molecular weight of 303.76 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: WQUWIRWFTDFGFT-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4S |
|---|---|
| Molecular weight | 303.76 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | WQUWIRWFTDFGFT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)