1-(4-Fluorophenyl)-1H-pyrazol-4-amine, 97%
cas: 1156602-69-5 — see every product listed under this CAS number, including other names
1-(4-Fluorophenyl)-1H-pyrazol-4-amine, 97% (CAS 1156602-69-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A993154-100mg |
| cas | 1156602-69-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 642.94 Pln | |
| Ambeed | 1g | 1605.25 Pln | |
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 1g | 1480.40 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 630.91 Pln | |
| BLDpharm | 1g | 1575.03 Pln | |
| Fluorochem | 100mg | 674.78 Pln | |
| Fluorochem | 250mg | 1080.89 Pln | |
| Fluorochem | 1g | 2746.97 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-fluorophenyl)pyrazol-4-amine (CAS 1156602-69-5) is a chemical compound with the molecular formula C9H8FN3 and a molecular weight of 177.18 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrazol-4-amine. InChIKey: UBKWWOPAKRZWTI-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3 |
|---|---|
| Molecular weight | 177.18 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrazol-4-amine |
| InChIKey | UBKWWOPAKRZWTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(C=N2)N)F |
Computed by PubChem (NCBI)