1-(4-Fluorophenyl)-4-iodo-1H-pyrazole, 95%
cas: 916451-05-3 — see every product listed under this CAS number, including other names
1-(4-Fluorophenyl)-4-iodo-1H-pyrazole, 95% (CAS 916451-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2004750-250mg |
| cas | 916451-05-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 993.38 Pln | |
| Ambeed | 10g | 1610.81 Pln | |
| Ambeed | 25g | 3168.31 Pln | |
| BLDpharm | 250mg | 192.18 Pln | |
| BLDpharm | 1g | 425.43 Pln | |
| BLDpharm | 5g | 1064.09 Pln | |
| BLDpharm | 10g | 1730.53 Pln | |
| BLDpharm | 25g | 3407.71 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 986.00 Pln | |
| Chemat | 10g | 1614.80 Pln | |
| Chemat | 25g | 3179.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-fluorophenyl)-4-iodopyrazole (CAS 916451-05-3) is a chemical compound with the molecular formula C9H6FIN2 and a molecular weight of 288.06 g/mol. IUPAC name: 1-(4-fluorophenyl)-4-iodopyrazole. InChIKey: KIVSYNQKZHDCNY-UHFFFAOYSA-N.
| Molecular formula | C9H6FIN2 |
|---|---|
| Molecular weight | 288.06 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4-iodopyrazole |
| InChIKey | KIVSYNQKZHDCNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(C=N2)I)F |
Computed by PubChem (NCBI)